C14H19Cl2N3O2 — CID 99820439
5-[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]pentanoic acid (PubChem CID 99820439) has the molecular formula C14H19Cl2N3O2 and a molecular weight of 332.23 g/mol. Its IUPAC name is 5-[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]pentanoic acid.
| Compound Name | 5-[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]pentanoic acid |
|---|---|
| PubChem CID | 99820439 |
| Molecular Formula | C14H19Cl2N3O2 |
| Molecular Weight | 332.23 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | 5-[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]pentanoic acid |
| SMILES | O=C(O)CCCCN1CCN(c2ncc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C14H19Cl2N3O2/c15-11-9-12(16)14(17-10-11)19-7-5-18(6-8-19)4-2-1-3-13(20)21/h9-10H,1-8H2,(H,20,21) |
| InChIKey | IGEHXPSUYSTGPV-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.23 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|