C20H27N5O4S2 — CID 23605772
1-[4-(4-pyrimidin-2-ylpiperazin-1-yl)sulfonylphenyl]sulfonylazepane (PubChem CID 23605772) has the molecular formula C20H27N5O4S2 and a molecular weight of 465.60 g/mol. Its IUPAC name is 1-[4-(4-pyrimidin-2-ylpiperazin-1-yl)sulfonylphenyl]sulfonylazepane.
| Compound Name | 1-[4-(4-pyrimidin-2-ylpiperazin-1-yl)sulfonylphenyl]sulfonylazepane |
|---|---|
| PubChem CID | 23605772 |
| Molecular Formula | C20H27N5O4S2 |
| Molecular Weight | 465.60 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | 1-[4-(4-pyrimidin-2-ylpiperazin-1-yl)sulfonylphenyl]sulfonylazepane |
| SMILES | O=S(=O)(c1ccc(S(=O)(=O)N2CCN(c3ncccn3)CC2)cc1)N1CCCCCC1 |
| InChI | InChI=1S/C20H27N5O4S2/c26-30(27,24-12-3-1-2-4-13-24)18-6-8-19(9-7-18)31(28,29)25-16-14-23(15-17-25)20-21-10-5-11-22-20/h5-11H,1-4,12-17H2 |
| InChIKey | YYEKQUFUXXCWLX-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 103.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.60 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |