C8H12N4O3S — CID 142758234
4-pyrimidin-2-ylpiperazine-1-sulfonic acid (PubChem CID 142758234) has the molecular formula C8H12N4O3S and a molecular weight of 244.28 g/mol. Its IUPAC name is 4-pyrimidin-2-ylpiperazine-1-sulfonic acid.
| Compound Name | 4-pyrimidin-2-ylpiperazine-1-sulfonic acid |
|---|---|
| PubChem CID | 142758234 |
| Molecular Formula | C8H12N4O3S |
| Molecular Weight | 244.28 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | 4-pyrimidin-2-ylpiperazine-1-sulfonic acid |
| SMILES | O=S(=O)(O)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C8H12N4O3S/c13-16(14,15)12-6-4-11(5-7-12)8-9-2-1-3-10-8/h1-3H,4-7H2,(H,13,14,15) |
| InChIKey | DEQNCVARUFMHQS-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.28 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|