C16H19N5O4S — CID 100814431
2-[4-(4-pyrimidin-2-ylpiperazin-1-yl)sulfonylphenoxy]acetamide (PubChem CID 100814431) has the molecular formula C16H19N5O4S and a molecular weight of 377.43 g/mol. Its IUPAC name is 2-[4-(4-pyrimidin-2-ylpiperazin-1-yl)sulfonylphenoxy]acetamide.
| Compound Name | 2-[4-(4-pyrimidin-2-ylpiperazin-1-yl)sulfonylphenoxy]acetamide |
|---|---|
| PubChem CID | 100814431 |
| Molecular Formula | C16H19N5O4S |
| Molecular Weight | 377.43 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | 2-[4-(4-pyrimidin-2-ylpiperazin-1-yl)sulfonylphenoxy]acetamide |
| SMILES | NC(=O)COc1ccc(S(=O)(=O)N2CCN(c3ncccn3)CC2)cc1 |
| InChI | InChI=1S/C16H19N5O4S/c17-15(22)12-25-13-2-4-14(5-3-13)26(23,24)21-10-8-20(9-11-21)16-18-6-1-7-19-16/h1-7H,8-12H2,(H2,17,22) |
| InChIKey | HTRNFZLCZTYIFN-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.43 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |