C20H24BrN5O3S — CID 11799370
[4-(4-bromophenyl)sulfonylpiperazin-1-yl]-(1-pyrimidin-2-ylpiperidin-4-yl)methanone (PubChem CID 11799370) has the molecular formula C20H24BrN5O3S and a molecular weight of 494.42 g/mol. Its IUPAC name is [4-(4-bromophenyl)sulfonylpiperazin-1-yl]-(1-pyrimidin-2-ylpiperidin-4-yl)methanone.
| Compound Name | [4-(4-bromophenyl)sulfonylpiperazin-1-yl]-(1-pyrimidin-2-ylpiperidin-4-yl)methanone |
|---|---|
| PubChem CID | 11799370 |
| Molecular Formula | C20H24BrN5O3S |
| Molecular Weight | 494.42 g/mol |
| Exact Mass | 493.08 |
| IUPAC Name | [4-(4-bromophenyl)sulfonylpiperazin-1-yl]-(1-pyrimidin-2-ylpiperidin-4-yl)methanone |
| SMILES | O=C(C1CCN(c2ncccn2)CC1)N1CCN(S(=O)(=O)c2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C20H24BrN5O3S/c21-17-2-4-18(5-3-17)30(28,29)26-14-12-24(13-15-26)19(27)16-6-10-25(11-7-16)20-22-8-1-9-23-20/h1-5,8-9,16H,6-7,10-15H2 |
| InChIKey | BDWWAACTRPHNRH-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 86.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.42 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |