C15H22N4O2S — CID 122563972
N-[3-(1-methylbenzimidazol-2-yl)propyl]pyrrolidine-1-sulfonamide (PubChem CID 122563972) has the molecular formula C15H22N4O2S and a molecular weight of 322.43 g/mol. Its IUPAC name is N-[3-(1-methylbenzimidazol-2-yl)propyl]pyrrolidine-1-sulfonamide.
| Compound Name | N-[3-(1-methylbenzimidazol-2-yl)propyl]pyrrolidine-1-sulfonamide |
|---|---|
| PubChem CID | 122563972 |
| Molecular Formula | C15H22N4O2S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | N-[3-(1-methylbenzimidazol-2-yl)propyl]pyrrolidine-1-sulfonamide |
| SMILES | Cn1c(CCCNS(=O)(=O)N2CCCC2)nc2ccccc21 |
| InChI | InChI=1S/C15H22N4O2S/c1-18-14-8-3-2-7-13(14)17-15(18)9-6-10-16-22(20,21)19-11-4-5-12-19/h2-3,7-8,16H,4-6,9-12H2,1H3 |
| InChIKey | FHPKTXMTHLMZMU-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|