C21H26N4O2S — CID 119109932
N-[(1-methylbenzimidazol-2-yl)methyl]-1-(2-piperidin-1-ylsulfonylphenyl)methanamine (PubChem CID 119109932) has the molecular formula C21H26N4O2S and a molecular weight of 398.53 g/mol. Its IUPAC name is N-[(1-methylbenzimidazol-2-yl)methyl]-1-(2-piperidin-1-ylsulfonylphenyl)methanamine.
| Compound Name | N-[(1-methylbenzimidazol-2-yl)methyl]-1-(2-piperidin-1-ylsulfonylphenyl)methanamine |
|---|---|
| PubChem CID | 119109932 |
| Molecular Formula | C21H26N4O2S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | N-[(1-methylbenzimidazol-2-yl)methyl]-1-(2-piperidin-1-ylsulfonylphenyl)methanamine |
| SMILES | Cn1c(CNCc2ccccc2S(=O)(=O)N2CCCCC2)nc2ccccc21 |
| InChI | InChI=1S/C21H26N4O2S/c1-24-19-11-5-4-10-18(19)23-21(24)16-22-15-17-9-3-6-12-20(17)28(26,27)25-13-7-2-8-14-25/h3-6,9-12,22H,2,7-8,13-16H2,1H3 |
| InChIKey | LFWLUPQDOMQSJR-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |