C17H26N2O2S — CID 75414784
N-[(2-piperidin-1-ylsulfonylphenyl)methyl]cyclopentanamine (PubChem CID 75414784) has the molecular formula C17H26N2O2S and a molecular weight of 322.47 g/mol. Its IUPAC name is N-[(2-piperidin-1-ylsulfonylphenyl)methyl]cyclopentanamine.
| Compound Name | N-[(2-piperidin-1-ylsulfonylphenyl)methyl]cyclopentanamine |
|---|---|
| PubChem CID | 75414784 |
| Molecular Formula | C17H26N2O2S |
| Molecular Weight | 322.47 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | N-[(2-piperidin-1-ylsulfonylphenyl)methyl]cyclopentanamine |
| SMILES | O=S(=O)(c1ccccc1CNC1CCCC1)N1CCCCC1 |
| InChI | InChI=1S/C17H26N2O2S/c20-22(21,19-12-6-1-7-13-19)17-11-5-2-8-15(17)14-18-16-9-3-4-10-16/h2,5,8,11,16,18H,1,3-4,6-7,9-10,12-14H2 |
| InChIKey | ZHFVCDXPNIUJRX-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.47 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |