C18H21N3O4S — CID 122053220
6-[(2-piperidin-1-ylsulfonylphenyl)methylamino]pyridine-2-carboxylic acid (PubChem CID 122053220) has the molecular formula C18H21N3O4S and a molecular weight of 375.45 g/mol. Its IUPAC name is 6-[(2-piperidin-1-ylsulfonylphenyl)methylamino]pyridine-2-carboxylic acid.
| Compound Name | 6-[(2-piperidin-1-ylsulfonylphenyl)methylamino]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 122053220 |
| Molecular Formula | C18H21N3O4S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 6-[(2-piperidin-1-ylsulfonylphenyl)methylamino]pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1cccc(NCc2ccccc2S(=O)(=O)N2CCCCC2)n1 |
| InChI | InChI=1S/C18H21N3O4S/c22-18(23)15-8-6-10-17(20-15)19-13-14-7-2-3-9-16(14)26(24,25)21-11-4-1-5-12-21/h2-3,6-10H,1,4-5,11-13H2,(H,19,20)(H,22,23) |
| InChIKey | NLXKMDHFBWDBJM-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |