C20H24N4O3S2 — CID 55465334
N-[(1-ethylbenzimidazol-2-yl)methyl]-3-piperidin-1-ylsulfonylthiophene-2-carboxamide (PubChem CID 55465334) has the molecular formula C20H24N4O3S2 and a molecular weight of 432.57 g/mol. Its IUPAC name is N-[(1-ethylbenzimidazol-2-yl)methyl]-3-piperidin-1-ylsulfonylthiophene-2-carboxamide.
| Compound Name | N-[(1-ethylbenzimidazol-2-yl)methyl]-3-piperidin-1-ylsulfonylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 55465334 |
| Molecular Formula | C20H24N4O3S2 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | N-[(1-ethylbenzimidazol-2-yl)methyl]-3-piperidin-1-ylsulfonylthiophene-2-carboxamide |
| SMILES | CCn1c(CNC(=O)c2sccc2S(=O)(=O)N2CCCCC2)nc2ccccc21 |
| InChI | InChI=1S/C20H24N4O3S2/c1-2-24-16-9-5-4-8-15(16)22-18(24)14-21-20(25)19-17(10-13-28-19)29(26,27)23-11-6-3-7-12-23/h4-5,8-10,13H,2-3,6-7,11-12,14H2,1H3,(H,21,25) |
| InChIKey | XKQBYCNWRGPJDB-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |