C10H18N4 — CID 64545973
N-[2-(1H-1,2,4-triazol-5-yl)ethyl]cyclohexanamine (PubChem CID 64545973) has the molecular formula C10H18N4 and a molecular weight of 194.28 g/mol. Its IUPAC name is N-[2-(1H-1,2,4-triazol-5-yl)ethyl]cyclohexanamine.
| Compound Name | N-[2-(1H-1,2,4-triazol-5-yl)ethyl]cyclohexanamine |
|---|---|
| PubChem CID | 64545973 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | N-[2-(1H-1,2,4-triazol-5-yl)ethyl]cyclohexanamine |
| SMILES | c1n[nH]c(CCNC2CCCCC2)n1 |
| InChI | InChI=1S/C10H18N4/c1-2-4-9(5-3-1)11-7-6-10-12-8-13-14-10/h8-9,11H,1-7H2,(H,12,13,14) |
| InChIKey | BWAZKXJLUOWHIW-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |