C9H19N7O — CID 106283168
1-amino-2-(3-methoxypropyl)-3-[1-(1H-1,2,4-triazol-5-yl)ethyl]guanidine (PubChem CID 106283168) has the molecular formula C9H19N7O and a molecular weight of 241.30 g/mol. Its IUPAC name is 1-amino-2-(3-methoxypropyl)-3-[1-(1H-1,2,4-triazol-5-yl)ethyl]guanidine.
| Compound Name | 1-amino-2-(3-methoxypropyl)-3-[1-(1H-1,2,4-triazol-5-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 106283168 |
| Molecular Formula | C9H19N7O |
| Molecular Weight | 241.30 g/mol |
| Exact Mass | 241.17 |
| IUPAC Name | 1-amino-2-(3-methoxypropyl)-3-[1-(1H-1,2,4-triazol-5-yl)ethyl]guanidine |
| SMILES | COCCC/N=C(\NN)NC(C)c1ncn[nH]1 |
| InChI | InChI=1S/C9H19N7O/c1-7(8-12-6-13-16-8)14-9(15-10)11-4-3-5-17-2/h6-7H,3-5,10H2,1-2H3,(H2,11,14,15)(H,12,13,16) |
| InChIKey | IXDVSGBWCCEGGS-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 113.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.30 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|