C9H16N6O — CID 107590564
1-amino-2-(3-methoxypropyl)-3-pyrimidin-5-ylguanidine (PubChem CID 107590564) has the molecular formula C9H16N6O and a molecular weight of 224.27 g/mol. Its IUPAC name is 1-amino-2-(3-methoxypropyl)-3-pyrimidin-5-ylguanidine.
| Compound Name | 1-amino-2-(3-methoxypropyl)-3-pyrimidin-5-ylguanidine |
|---|---|
| PubChem CID | 107590564 |
| Molecular Formula | C9H16N6O |
| Molecular Weight | 224.27 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | 1-amino-2-(3-methoxypropyl)-3-pyrimidin-5-ylguanidine |
| SMILES | COCCC/N=C(\NN)Nc1cncnc1 |
| InChI | InChI=1S/C9H16N6O/c1-16-4-2-3-13-9(15-10)14-8-5-11-7-12-6-8/h5-7H,2-4,10H2,1H3,(H2,13,14,15) |
| InChIKey | LGCLVTXIJIZCLT-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 97.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.27 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|