C11H15F3N4O — CID 116511165
1-amino-2-(3-methoxypropyl)-3-(3,4,5-trifluorophenyl)guanidine (PubChem CID 116511165) has the molecular formula C11H15F3N4O and a molecular weight of 276.26 g/mol. Its IUPAC name is 1-amino-2-(3-methoxypropyl)-3-(3,4,5-trifluorophenyl)guanidine.
| Compound Name | 1-amino-2-(3-methoxypropyl)-3-(3,4,5-trifluorophenyl)guanidine |
|---|---|
| PubChem CID | 116511165 |
| Molecular Formula | C11H15F3N4O |
| Molecular Weight | 276.26 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 1-amino-2-(3-methoxypropyl)-3-(3,4,5-trifluorophenyl)guanidine |
| SMILES | COCCC/N=C(\NN)Nc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C11H15F3N4O/c1-19-4-2-3-16-11(18-15)17-7-5-8(12)10(14)9(13)6-7/h5-6H,2-4,15H2,1H3,(H2,16,17,18) |
| InChIKey | JPGKLGGAGYXODD-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 71.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.26 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|