C12H16F4N4O — CID 116513750
1-amino-3-[4-fluoro-3-(trifluoromethyl)phenyl]-2-(3-methoxypropyl)guanidine (PubChem CID 116513750) has the molecular formula C12H16F4N4O and a molecular weight of 308.28 g/mol. Its IUPAC name is 1-amino-3-[4-fluoro-3-(trifluoromethyl)phenyl]-2-(3-methoxypropyl)guanidine.
| Compound Name | 1-amino-3-[4-fluoro-3-(trifluoromethyl)phenyl]-2-(3-methoxypropyl)guanidine |
|---|---|
| PubChem CID | 116513750 |
| Molecular Formula | C12H16F4N4O |
| Molecular Weight | 308.28 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 1-amino-3-[4-fluoro-3-(trifluoromethyl)phenyl]-2-(3-methoxypropyl)guanidine |
| SMILES | COCCC/N=C(\NN)Nc1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H16F4N4O/c1-21-6-2-5-18-11(20-17)19-8-3-4-10(13)9(7-8)12(14,15)16/h3-4,7H,2,5-6,17H2,1H3,(H2,18,19,20) |
| InChIKey | PBVPSFPIXMCWSS-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 71.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.28 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|