C11H16BrClN4O — CID 116515767
1-amino-3-(3-bromo-4-chlorophenyl)-2-(3-methoxypropyl)guanidine (PubChem CID 116515767) has the molecular formula C11H16BrClN4O and a molecular weight of 335.63 g/mol. Its IUPAC name is 1-amino-3-(3-bromo-4-chlorophenyl)-2-(3-methoxypropyl)guanidine.
| Compound Name | 1-amino-3-(3-bromo-4-chlorophenyl)-2-(3-methoxypropyl)guanidine |
|---|---|
| PubChem CID | 116515767 |
| Molecular Formula | C11H16BrClN4O |
| Molecular Weight | 335.63 g/mol |
| Exact Mass | 334.02 |
| IUPAC Name | 1-amino-3-(3-bromo-4-chlorophenyl)-2-(3-methoxypropyl)guanidine |
| SMILES | COCCC/N=C(\NN)Nc1ccc(Cl)c(Br)c1 |
| InChI | InChI=1S/C11H16BrClN4O/c1-18-6-2-5-15-11(17-14)16-8-3-4-10(13)9(12)7-8/h3-4,7H,2,5-6,14H2,1H3,(H2,15,16,17) |
| InChIKey | LXHUXHNETRVWNH-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 71.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.63 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|