C11H16BrFN4O — CID 116516443
1-amino-3-(3-bromo-4-fluorophenyl)-2-(1-methoxypropan-2-yl)guanidine (PubChem CID 116516443) has the molecular formula C11H16BrFN4O and a molecular weight of 319.18 g/mol. Its IUPAC name is 1-amino-3-(3-bromo-4-fluorophenyl)-2-(1-methoxypropan-2-yl)guanidine.
| Compound Name | 1-amino-3-(3-bromo-4-fluorophenyl)-2-(1-methoxypropan-2-yl)guanidine |
|---|---|
| PubChem CID | 116516443 |
| Molecular Formula | C11H16BrFN4O |
| Molecular Weight | 319.18 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | 1-amino-3-(3-bromo-4-fluorophenyl)-2-(1-methoxypropan-2-yl)guanidine |
| SMILES | COCC(C)/N=C(\NN)Nc1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C11H16BrFN4O/c1-7(6-18-2)15-11(17-14)16-8-3-4-10(13)9(12)5-8/h3-5,7H,6,14H2,1-2H3,(H2,15,16,17) |
| InChIKey | MFJZOTZAWNYOFM-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 71.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.18 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|