C11H15ClF2N4O — CID 104887980
1-amino-3-(2-chloro-4,6-difluorophenyl)-2-(1-methoxypropan-2-yl)guanidine (PubChem CID 104887980) has the molecular formula C11H15ClF2N4O and a molecular weight of 292.72 g/mol. Its IUPAC name is 1-amino-3-(2-chloro-4,6-difluorophenyl)-2-(1-methoxypropan-2-yl)guanidine.
| Compound Name | 1-amino-3-(2-chloro-4,6-difluorophenyl)-2-(1-methoxypropan-2-yl)guanidine |
|---|---|
| PubChem CID | 104887980 |
| Molecular Formula | C11H15ClF2N4O |
| Molecular Weight | 292.72 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 1-amino-3-(2-chloro-4,6-difluorophenyl)-2-(1-methoxypropan-2-yl)guanidine |
| SMILES | COCC(C)/N=C(\NN)Nc1c(F)cc(F)cc1Cl |
| InChI | InChI=1S/C11H15ClF2N4O/c1-6(5-19-2)16-11(18-15)17-10-8(12)3-7(13)4-9(10)14/h3-4,6H,5,15H2,1-2H3,(H2,16,17,18) |
| InChIKey | DMJLNHDSBRAASF-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 71.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.72 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|