C11H19N5O — CID 116511413
1-amino-2-(3-ethoxypropyl)-3-pyridin-3-ylguanidine (PubChem CID 116511413) has the molecular formula C11H19N5O and a molecular weight of 237.31 g/mol. Its IUPAC name is 1-amino-2-(3-ethoxypropyl)-3-pyridin-3-ylguanidine.
| Compound Name | 1-amino-2-(3-ethoxypropyl)-3-pyridin-3-ylguanidine |
|---|---|
| PubChem CID | 116511413 |
| Molecular Formula | C11H19N5O |
| Molecular Weight | 237.31 g/mol |
| Exact Mass | 237.16 |
| IUPAC Name | 1-amino-2-(3-ethoxypropyl)-3-pyridin-3-ylguanidine |
| SMILES | CCOCCC/N=C(\NN)Nc1cccnc1 |
| InChI | InChI=1S/C11H19N5O/c1-2-17-8-4-7-14-11(16-12)15-10-5-3-6-13-9-10/h3,5-6,9H,2,4,7-8,12H2,1H3,(H2,14,15,16) |
| InChIKey | KDXIXWSPBBXQSK-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 84.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.31 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|