C14H24N4O — CID 116512527
1-amino-3-(2,6-dimethylphenyl)-2-(3-ethoxypropyl)guanidine (PubChem CID 116512527) has the molecular formula C14H24N4O and a molecular weight of 264.37 g/mol. Its IUPAC name is 1-amino-3-(2,6-dimethylphenyl)-2-(3-ethoxypropyl)guanidine.
| Compound Name | 1-amino-3-(2,6-dimethylphenyl)-2-(3-ethoxypropyl)guanidine |
|---|---|
| PubChem CID | 116512527 |
| Molecular Formula | C14H24N4O |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.20 |
| IUPAC Name | 1-amino-3-(2,6-dimethylphenyl)-2-(3-ethoxypropyl)guanidine |
| SMILES | CCOCCC/N=C(\NN)Nc1c(C)cccc1C |
| InChI | InChI=1S/C14H24N4O/c1-4-19-10-6-9-16-14(18-15)17-13-11(2)7-5-8-12(13)3/h5,7-8H,4,6,9-10,15H2,1-3H3,(H2,16,17,18) |
| InChIKey | BPDBNGBOWXZVBU-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 71.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|