C10H16N4 — CID 116510703
1-amino-3-(2,6-dimethylphenyl)-2-methylguanidine (PubChem CID 116510703) has the molecular formula C10H16N4 and a molecular weight of 192.27 g/mol. Its IUPAC name is 1-amino-3-(2,6-dimethylphenyl)-2-methylguanidine.
| Compound Name | 1-amino-3-(2,6-dimethylphenyl)-2-methylguanidine |
|---|---|
| PubChem CID | 116510703 |
| Molecular Formula | C10H16N4 |
| Molecular Weight | 192.27 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | 1-amino-3-(2,6-dimethylphenyl)-2-methylguanidine |
| SMILES | C/N=C(\NN)Nc1c(C)cccc1C |
| InChI | InChI=1S/C10H16N4/c1-7-5-4-6-8(2)9(7)13-10(12-3)14-11/h4-6H,11H2,1-3H3,(H2,12,13,14) |
| InChIKey | JESNTZIPMDCPGY-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.27 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|