C11H16ClN4O- — CID 53351559
1-(2,6-dimethylphenyl)-3-(N'-methylcarbamimidoyl)urea chloride (PubChem CID 53351559) has the molecular formula C11H16ClN4O- and a molecular weight of 255.73 g/mol. Its IUPAC name is 1-(2,6-dimethylphenyl)-3-(N'-methylcarbamimidoyl)urea chloride.
| Compound Name | 1-(2,6-dimethylphenyl)-3-(N'-methylcarbamimidoyl)urea chloride |
|---|---|
| PubChem CID | 53351559 |
| Molecular Formula | C11H16ClN4O- |
| Molecular Weight | 255.73 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 1-(2,6-dimethylphenyl)-3-(N'-methylcarbamimidoyl)urea chloride |
| SMILES | C/N=C(\N)NC(=O)Nc1c(C)cccc1C.[Cl-] |
| InChI | InChI=1S/C11H16N4O.ClH/c1-7-5-4-6-8(2)9(7)14-11(16)15-10(12)13-3;/h4-6H,1-3H3,(H4,12,13,14,15,16);1H/p-1 |
| InChIKey | INMBONSHXVMDSX-UHFFFAOYSA-M |
| XLogP | -1.63 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.73 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|