C14H22N4O — CID 13023382
1-(N'-butylcarbamimidoyl)-3-(2,6-dimethylphenyl)urea (PubChem CID 13023382) has the molecular formula C14H22N4O and a molecular weight of 262.36 g/mol. Its IUPAC name is 1-(N'-butylcarbamimidoyl)-3-(2,6-dimethylphenyl)urea.
| Compound Name | 1-(N'-butylcarbamimidoyl)-3-(2,6-dimethylphenyl)urea |
|---|---|
| PubChem CID | 13023382 |
| Molecular Formula | C14H22N4O |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | 1-(N'-butylcarbamimidoyl)-3-(2,6-dimethylphenyl)urea |
| SMILES | CCCC/N=C(\N)NC(=O)Nc1c(C)cccc1C |
| InChI | InChI=1S/C14H22N4O/c1-4-5-9-16-13(15)18-14(19)17-12-10(2)7-6-8-11(12)3/h6-8H,4-5,9H2,1-3H3,(H4,15,16,17,18,19) |
| InChIKey | UMKJHKDOHHYIEK-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|