C49H80N12O3 — CID 163626796
bis(1-(N'-butylcarbamimidoyl)-3-(2,6-diethylphenyl)urea);1-(2,6-diethylphenyl)-3-(N'-pentylcarbamimidoyl)urea (PubChem CID 163626796) has the molecular formula C49H80N12O3 and a molecular weight of 885.26 g/mol. Its IUPAC name is bis(1-(N'-butylcarbamimidoyl)-3-(2,6-diethylphenyl)urea);1-(2,6-diethylphenyl)-3-(N'-pentylcarbamimidoyl)urea.
| Compound Name | bis(1-(N'-butylcarbamimidoyl)-3-(2,6-diethylphenyl)urea);1-(2,6-diethylphenyl)-3-(N'-pentylcarbamimidoyl)urea |
|---|---|
| PubChem CID | 163626796 |
| Molecular Formula | C49H80N12O3 |
| Molecular Weight | 885.26 g/mol |
| Exact Mass | 884.65 |
| IUPAC Name | bis(1-(N'-butylcarbamimidoyl)-3-(2,6-diethylphenyl)urea);1-(2,6-diethylphenyl)-3-(N'-pentylcarbamimidoyl)urea |
| SMILES | CCCC/N=C(\N)NC(=O)Nc1c(CC)cccc1CC.CCCC/N=C(\N)NC(=O)Nc1c(CC)cccc1CC.CCCCC/N=C(\N)NC(=O)Nc1c(CC)cccc1CC |
| InChI | InChI=1S/C17H28N4O.2C16H26N4O/c1-4-7-8-12-19-16(18)21-17(22)20-15-13(5-2)10-9-11-14(15)6-3;2*1-4-7-11-18-15(17)20-16(21)19-14-12(5-2)9-8-10-13(14)6-3/h9-11H,4-8,12H2,1-3H3,(H4,18,19,20,21,22);2*8-10H,4-7,11H2,1-3H3,(H4,17,18,19,20,21) |
| InChIKey | HSSDLLCKPGDCLL-UHFFFAOYSA-N |
| XLogP | 9.53 |
| TPSA | 238.53 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 885.26 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|