C19H33N3O2 — CID 111821789
2-[2-(2-butoxyethoxy)ethyl]-1-(2,6-diethylphenyl)guanidine (PubChem CID 111821789) has the molecular formula C19H33N3O2 and a molecular weight of 335.49 g/mol. Its IUPAC name is 2-[2-(2-butoxyethoxy)ethyl]-1-(2,6-diethylphenyl)guanidine.
| Compound Name | 2-[2-(2-butoxyethoxy)ethyl]-1-(2,6-diethylphenyl)guanidine |
|---|---|
| PubChem CID | 111821789 |
| Molecular Formula | C19H33N3O2 |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.26 |
| IUPAC Name | 2-[2-(2-butoxyethoxy)ethyl]-1-(2,6-diethylphenyl)guanidine |
| SMILES | CCCCOCCOCC/N=C(\N)Nc1c(CC)cccc1CC |
| InChI | InChI=1S/C19H33N3O2/c1-4-7-12-23-14-15-24-13-11-21-19(20)22-18-16(5-2)9-8-10-17(18)6-3/h8-10H,4-7,11-15H2,1-3H3,(H3,20,21,22) |
| InChIKey | OCUWZTNEXQWOBM-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|