C12H17ClN2O — CID 13326597
1-(3-chloropropyl)-3-(2,6-dimethylphenyl)urea (PubChem CID 13326597) has the molecular formula C12H17ClN2O and a molecular weight of 240.73 g/mol. Its IUPAC name is 1-(3-chloropropyl)-3-(2,6-dimethylphenyl)urea.
| Compound Name | 1-(3-chloropropyl)-3-(2,6-dimethylphenyl)urea |
|---|---|
| PubChem CID | 13326597 |
| Molecular Formula | C12H17ClN2O |
| Molecular Weight | 240.73 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 1-(3-chloropropyl)-3-(2,6-dimethylphenyl)urea |
| SMILES | Cc1cccc(C)c1NC(=O)NCCCCl |
| InChI | InChI=1S/C12H17ClN2O/c1-9-5-3-6-10(2)11(9)15-12(16)14-8-4-7-13/h3,5-6H,4,7-8H2,1-2H3,(H2,14,15,16) |
| InChIKey | AKHPDLLFLBNVKH-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.73 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|