C11H15FN2O — CID 59778684
1-(2,6-dimethylphenyl)-3-(2-fluoroethyl)urea (PubChem CID 59778684) has the molecular formula C11H15FN2O and a molecular weight of 210.25 g/mol. Its IUPAC name is 1-(2,6-dimethylphenyl)-3-(2-fluoroethyl)urea.
| Compound Name | 1-(2,6-dimethylphenyl)-3-(2-fluoroethyl)urea |
|---|---|
| PubChem CID | 59778684 |
| Molecular Formula | C11H15FN2O |
| Molecular Weight | 210.25 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | 1-(2,6-dimethylphenyl)-3-(2-fluoroethyl)urea |
| SMILES | Cc1cccc(C)c1NC(=O)NCCF |
| InChI | InChI=1S/C11H15FN2O/c1-8-4-3-5-9(2)10(8)14-11(15)13-7-6-12/h3-5H,6-7H2,1-2H3,(H2,13,14,15) |
| InChIKey | XPLIDZLOEKRCKH-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.25 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |