C15H25Cl2N3O — CID 21153854
1-(2-chloro-6-methylphenyl)-3-[3-(diethylamino)propyl]urea;hydrochloride (PubChem CID 21153854) has the molecular formula C15H25Cl2N3O and a molecular weight of 334.29 g/mol. Its IUPAC name is 1-(2-chloro-6-methylphenyl)-3-[3-(diethylamino)propyl]urea;hydrochloride.
| Compound Name | 1-(2-chloro-6-methylphenyl)-3-[3-(diethylamino)propyl]urea;hydrochloride |
|---|---|
| PubChem CID | 21153854 |
| Molecular Formula | C15H25Cl2N3O |
| Molecular Weight | 334.29 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | 1-(2-chloro-6-methylphenyl)-3-[3-(diethylamino)propyl]urea;hydrochloride |
| SMILES | CCN(CC)CCCNC(=O)Nc1c(C)cccc1Cl.Cl |
| InChI | InChI=1S/C15H24ClN3O.ClH/c1-4-19(5-2)11-7-10-17-15(20)18-14-12(3)8-6-9-13(14)16;/h6,8-9H,4-5,7,10-11H2,1-3H3,(H2,17,18,20);1H |
| InChIKey | QQPDLVWAAHBWBN-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.29 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|