C12H15ClN2O4 — CID 79463759
2-[2-[(2-chloro-6-methylphenyl)carbamoylamino]ethoxy]acetic acid (PubChem CID 79463759) has the molecular formula C12H15ClN2O4 and a molecular weight of 286.72 g/mol. Its IUPAC name is 2-[2-[(2-chloro-6-methylphenyl)carbamoylamino]ethoxy]acetic acid.
| Compound Name | 2-[2-[(2-chloro-6-methylphenyl)carbamoylamino]ethoxy]acetic acid |
|---|---|
| PubChem CID | 79463759 |
| Molecular Formula | C12H15ClN2O4 |
| Molecular Weight | 286.72 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | 2-[2-[(2-chloro-6-methylphenyl)carbamoylamino]ethoxy]acetic acid |
| SMILES | Cc1cccc(Cl)c1NC(=O)NCCOCC(=O)O |
| InChI | InChI=1S/C12H15ClN2O4/c1-8-3-2-4-9(13)11(8)15-12(18)14-5-6-19-7-10(16)17/h2-4H,5-7H2,1H3,(H,16,17)(H2,14,15,18) |
| InChIKey | BLUKLGDIPNZGGO-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.72 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|