C14H21ClFN3O — CID 108896533
1-(2-chloro-6-fluorophenyl)-3-[3-(diethylamino)propyl]urea (PubChem CID 108896533) has the molecular formula C14H21ClFN3O and a molecular weight of 301.79 g/mol. Its IUPAC name is 1-(2-chloro-6-fluorophenyl)-3-[3-(diethylamino)propyl]urea.
| Compound Name | 1-(2-chloro-6-fluorophenyl)-3-[3-(diethylamino)propyl]urea |
|---|---|
| PubChem CID | 108896533 |
| Molecular Formula | C14H21ClFN3O |
| Molecular Weight | 301.79 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 1-(2-chloro-6-fluorophenyl)-3-[3-(diethylamino)propyl]urea |
| SMILES | CCN(CC)CCCNC(=O)Nc1c(F)cccc1Cl |
| InChI | InChI=1S/C14H21ClFN3O/c1-3-19(4-2)10-6-9-17-14(20)18-13-11(15)7-5-8-12(13)16/h5,7-8H,3-4,6,9-10H2,1-2H3,(H2,17,18,20) |
| InChIKey | QNCSTHZWIQTKQM-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.79 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|