C12H21N3OS — CID 108889188
1-[3-(diethylamino)propyl]-3-thiophen-2-ylurea (PubChem CID 108889188) has the molecular formula C12H21N3OS and a molecular weight of 255.39 g/mol. Its IUPAC name is 1-[3-(diethylamino)propyl]-3-thiophen-2-ylurea.
| Compound Name | 1-[3-(diethylamino)propyl]-3-thiophen-2-ylurea |
|---|---|
| PubChem CID | 108889188 |
| Molecular Formula | C12H21N3OS |
| Molecular Weight | 255.39 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 1-[3-(diethylamino)propyl]-3-thiophen-2-ylurea |
| SMILES | CCN(CC)CCCNC(=O)Nc1cccs1 |
| InChI | InChI=1S/C12H21N3OS/c1-3-15(4-2)9-6-8-13-12(16)14-11-7-5-10-17-11/h5,7,10H,3-4,6,8-9H2,1-2H3,(H2,13,14,16) |
| InChIKey | SZPRUZDVQPKQLD-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.39 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|