C15H25ClN4O — CID 70615053
1-(2,6-dimethylphenyl)-3-(N'-pentan-2-ylcarbamimidoyl)urea;hydrochloride (PubChem CID 70615053) has the molecular formula C15H25ClN4O and a molecular weight of 312.85 g/mol. Its IUPAC name is 1-(2,6-dimethylphenyl)-3-(N'-pentan-2-ylcarbamimidoyl)urea;hydrochloride.
| Compound Name | 1-(2,6-dimethylphenyl)-3-(N'-pentan-2-ylcarbamimidoyl)urea;hydrochloride |
|---|---|
| PubChem CID | 70615053 |
| Molecular Formula | C15H25ClN4O |
| Molecular Weight | 312.85 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 1-(2,6-dimethylphenyl)-3-(N'-pentan-2-ylcarbamimidoyl)urea;hydrochloride |
| SMILES | CCCC(C)/N=C(\N)NC(=O)Nc1c(C)cccc1C.Cl |
| InChI | InChI=1S/C15H24N4O.ClH/c1-5-7-12(4)17-14(16)19-15(20)18-13-10(2)8-6-9-11(13)3;/h6,8-9,12H,5,7H2,1-4H3,(H4,16,17,18,19,20);1H |
| InChIKey | IOGJEPXNENQAMF-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.85 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|