C10H14Cl2N4O2 — CID 158055964
1-(2-chloro-6-methylphenyl)-3-(N'-methoxycarbamimidoyl)urea;hydrochloride (PubChem CID 158055964) has the molecular formula C10H14Cl2N4O2 and a molecular weight of 293.15 g/mol. Its IUPAC name is 1-(2-chloro-6-methylphenyl)-3-(N'-methoxycarbamimidoyl)urea;hydrochloride.
| Compound Name | 1-(2-chloro-6-methylphenyl)-3-(N'-methoxycarbamimidoyl)urea;hydrochloride |
|---|---|
| PubChem CID | 158055964 |
| Molecular Formula | C10H14Cl2N4O2 |
| Molecular Weight | 293.15 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | 1-(2-chloro-6-methylphenyl)-3-(N'-methoxycarbamimidoyl)urea;hydrochloride |
| SMILES | CON=C(N)NC(=O)Nc1c(C)cccc1Cl.Cl |
| InChI | InChI=1S/C10H13ClN4O2.ClH/c1-6-4-3-5-7(11)8(6)13-10(16)14-9(12)15-17-2;/h3-5H,1-2H3,(H4,12,13,14,15,16);1H |
| InChIKey | FKBCNTVHZVMTMY-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.15 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|