C10H12BrClN4O2 — CID 159080557
1-(4-bromo-2-chloro-6-methylphenyl)-3-(N'-methoxycarbamimidoyl)urea (PubChem CID 159080557) has the molecular formula C10H12BrClN4O2 and a molecular weight of 335.59 g/mol. Its IUPAC name is 1-(4-bromo-2-chloro-6-methylphenyl)-3-(N'-methoxycarbamimidoyl)urea.
| Compound Name | 1-(4-bromo-2-chloro-6-methylphenyl)-3-(N'-methoxycarbamimidoyl)urea |
|---|---|
| PubChem CID | 159080557 |
| Molecular Formula | C10H12BrClN4O2 |
| Molecular Weight | 335.59 g/mol |
| Exact Mass | 333.98 |
| IUPAC Name | 1-(4-bromo-2-chloro-6-methylphenyl)-3-(N'-methoxycarbamimidoyl)urea |
| SMILES | CON=C(N)NC(=O)Nc1c(C)cc(Br)cc1Cl |
| InChI | InChI=1S/C10H12BrClN4O2/c1-5-3-6(11)4-7(12)8(5)14-10(17)15-9(13)16-18-2/h3-4H,1-2H3,(H4,13,14,15,16,17) |
| InChIKey | MJRHTJBKNQTEOO-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.59 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|