C12H19ClN4O — CID 3049564
1-(N'-methylcarbamimidoyl)-3-(2,4,6-trimethylphenyl)urea;hydrochloride (PubChem CID 3049564) has the molecular formula C12H19ClN4O and a molecular weight of 270.76 g/mol. Its IUPAC name is 1-(N'-methylcarbamimidoyl)-3-(2,4,6-trimethylphenyl)urea;hydrochloride.
| Compound Name | 1-(N'-methylcarbamimidoyl)-3-(2,4,6-trimethylphenyl)urea;hydrochloride |
|---|---|
| PubChem CID | 3049564 |
| Molecular Formula | C12H19ClN4O |
| Molecular Weight | 270.76 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 1-(N'-methylcarbamimidoyl)-3-(2,4,6-trimethylphenyl)urea;hydrochloride |
| SMILES | C/N=C(\N)NC(=O)Nc1c(C)cc(C)cc1C.Cl |
| InChI | InChI=1S/C12H18N4O.ClH/c1-7-5-8(2)10(9(3)6-7)15-12(17)16-11(13)14-4;/h5-6H,1-4H3,(H4,13,14,15,16,17);1H |
| InChIKey | TZWIWPFISMXCIG-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.76 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|