C18H21NO — CID 918543
3,5-dimethyl-N-(2,4,6-trimethylphenyl)benzamide (PubChem CID 918543) has the molecular formula C18H21NO and a molecular weight of 267.37 g/mol. Its IUPAC name is 3,5-dimethyl-N-(2,4,6-trimethylphenyl)benzamide.
| Compound Name | 3,5-dimethyl-N-(2,4,6-trimethylphenyl)benzamide |
|---|---|
| PubChem CID | 918543 |
| Molecular Formula | C18H21NO |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 3,5-dimethyl-N-(2,4,6-trimethylphenyl)benzamide |
| SMILES | Cc1cc(C)cc(C(=O)Nc2c(C)cc(C)cc2C)c1 |
| InChI | InChI=1S/C18H21NO/c1-11-6-12(2)10-16(9-11)18(20)19-17-14(4)7-13(3)8-15(17)5/h6-10H,1-5H3,(H,19,20) |
| InChIKey | HDQQTSRNCCMJQP-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |