C14H14BrNOS — CID 43424527
5-bromo-N-(2,4,6-trimethylphenyl)thiophene-3-carboxamide (PubChem CID 43424527) has the molecular formula C14H14BrNOS and a molecular weight of 324.24 g/mol. Its IUPAC name is 5-bromo-N-(2,4,6-trimethylphenyl)thiophene-3-carboxamide.
| Compound Name | 5-bromo-N-(2,4,6-trimethylphenyl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 43424527 |
| Molecular Formula | C14H14BrNOS |
| Molecular Weight | 324.24 g/mol |
| Exact Mass | 323.00 |
| IUPAC Name | 5-bromo-N-(2,4,6-trimethylphenyl)thiophene-3-carboxamide |
| SMILES | Cc1cc(C)c(NC(=O)c2csc(Br)c2)c(C)c1 |
| InChI | InChI=1S/C14H14BrNOS/c1-8-4-9(2)13(10(3)5-8)16-14(17)11-6-12(15)18-7-11/h4-7H,1-3H3,(H,16,17) |
| InChIKey | MOJUHHLKOJZETA-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.24 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |