C17H17NO2S — CID 79692226
5-(3-hydroxyprop-1-ynyl)-N-(2,4,6-trimethylphenyl)thiophene-3-carboxamide (PubChem CID 79692226) has the molecular formula C17H17NO2S and a molecular weight of 299.40 g/mol. Its IUPAC name is 5-(3-hydroxyprop-1-ynyl)-N-(2,4,6-trimethylphenyl)thiophene-3-carboxamide.
| Compound Name | 5-(3-hydroxyprop-1-ynyl)-N-(2,4,6-trimethylphenyl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 79692226 |
| Molecular Formula | C17H17NO2S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 5-(3-hydroxyprop-1-ynyl)-N-(2,4,6-trimethylphenyl)thiophene-3-carboxamide |
| SMILES | Cc1cc(C)c(NC(=O)c2csc(C#CCO)c2)c(C)c1 |
| InChI | InChI=1S/C17H17NO2S/c1-11-7-12(2)16(13(3)8-11)18-17(20)14-9-15(21-10-14)5-4-6-19/h7-10,19H,6H2,1-3H3,(H,18,20) |
| InChIKey | SMSZVQPDANSJTB-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|