C14H9F2NO2S — CID 79696601
N-(2,4-difluorophenyl)-5-(3-hydroxyprop-1-ynyl)thiophene-3-carboxamide (PubChem CID 79696601) has the molecular formula C14H9F2NO2S and a molecular weight of 293.29 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-5-(3-hydroxyprop-1-ynyl)thiophene-3-carboxamide.
| Compound Name | N-(2,4-difluorophenyl)-5-(3-hydroxyprop-1-ynyl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 79696601 |
| Molecular Formula | C14H9F2NO2S |
| Molecular Weight | 293.29 g/mol |
| Exact Mass | 293.03 |
| IUPAC Name | N-(2,4-difluorophenyl)-5-(3-hydroxyprop-1-ynyl)thiophene-3-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1F)c1csc(C#CCO)c1 |
| InChI | InChI=1S/C14H9F2NO2S/c15-10-3-4-13(12(16)7-10)17-14(19)9-6-11(20-8-9)2-1-5-18/h3-4,6-8,18H,5H2,(H,17,19) |
| InChIKey | SFPHPCHEWUEQQP-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.29 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|