C13H17NO2S — CID 79694004
5-(3-hydroxyprop-1-ynyl)-N-pentan-3-ylthiophene-3-carboxamide (PubChem CID 79694004) has the molecular formula C13H17NO2S and a molecular weight of 251.35 g/mol. Its IUPAC name is 5-(3-hydroxyprop-1-ynyl)-N-pentan-3-ylthiophene-3-carboxamide.
| Compound Name | 5-(3-hydroxyprop-1-ynyl)-N-pentan-3-ylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 79694004 |
| Molecular Formula | C13H17NO2S |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | 5-(3-hydroxyprop-1-ynyl)-N-pentan-3-ylthiophene-3-carboxamide |
| SMILES | CCC(CC)NC(=O)c1csc(C#CCO)c1 |
| InChI | InChI=1S/C13H17NO2S/c1-3-11(4-2)14-13(16)10-8-12(17-9-10)6-5-7-15/h8-9,11,15H,3-4,7H2,1-2H3,(H,14,16) |
| InChIKey | QFDYLMSKJHYPEC-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|