C12H19N5 — CID 88753489
(1E)-1-[amino-(2,4,6-trimethylanilino)methylidene]-2-methylguanidine (PubChem CID 88753489) has the molecular formula C12H19N5 and a molecular weight of 233.32 g/mol. Its IUPAC name is (1E)-1-[amino-(2,4,6-trimethylanilino)methylidene]-2-methylguanidine.
| Compound Name | (1E)-1-[amino-(2,4,6-trimethylanilino)methylidene]-2-methylguanidine |
|---|---|
| PubChem CID | 88753489 |
| Molecular Formula | C12H19N5 |
| Molecular Weight | 233.32 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | (1E)-1-[amino-(2,4,6-trimethylanilino)methylidene]-2-methylguanidine |
| SMILES | C/N=C(N)/N=C(\N)Nc1c(C)cc(C)cc1C |
| InChI | InChI=1S/C12H19N5/c1-7-5-8(2)10(9(3)6-7)16-12(14)17-11(13)15-4/h5-6H,1-4H3,(H5,13,14,15,16,17) |
| InChIKey | APXHQBNWWDZFDU-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 88.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.32 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|