C38H46N4 — CID 5246161
1-N,1-N',2-N,2-N'-tetrakis(2,4,6-trimethylphenyl)ethanediimidamide (PubChem CID 5246161) has the molecular formula C38H46N4 and a molecular weight of 558.81 g/mol. Its IUPAC name is 1-N,1-N',2-N,2-N'-tetrakis(2,4,6-trimethylphenyl)ethanediimidamide.
| Compound Name | 1-N,1-N',2-N,2-N'-tetrakis(2,4,6-trimethylphenyl)ethanediimidamide |
|---|---|
| PubChem CID | 5246161 |
| Molecular Formula | C38H46N4 |
| Molecular Weight | 558.81 g/mol |
| Exact Mass | 558.37 |
| IUPAC Name | 1-N,1-N',2-N,2-N'-tetrakis(2,4,6-trimethylphenyl)ethanediimidamide |
| SMILES | Cc1cc(C)c(/N=C(Nc2c(C)cc(C)cc2C)/C(=N\c2c(C)cc(C)cc2C)Nc2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C38H46N4/c1-21-13-25(5)33(26(6)14-21)39-37(40-34-27(7)15-22(2)16-28(34)8)38(41-35-29(9)17-23(3)18-30(35)10)42-36-31(11)19-24(4)20-32(36)12/h13-20H,1-12H3,(H,39,40)(H,41,42) |
| InChIKey | SNQDJXMLDDSXPJ-UHFFFAOYSA-N |
| XLogP | 10.37 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.81 |
| LogP ≤ 5 | 10.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|