C23H32N2 — CID 102367216
2,4,6-trimethyl-N-[4-(2,4,6-trimethylphenyl)iminopentan-2-yl]aniline (PubChem CID 102367216) has the molecular formula C23H32N2 and a molecular weight of 336.52 g/mol. Its IUPAC name is 2,4,6-trimethyl-N-[4-(2,4,6-trimethylphenyl)iminopentan-2-yl]aniline.
| Compound Name | 2,4,6-trimethyl-N-[4-(2,4,6-trimethylphenyl)iminopentan-2-yl]aniline |
|---|---|
| PubChem CID | 102367216 |
| Molecular Formula | C23H32N2 |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.26 |
| IUPAC Name | 2,4,6-trimethyl-N-[4-(2,4,6-trimethylphenyl)iminopentan-2-yl]aniline |
| SMILES | C/C(CC(C)Nc1c(C)cc(C)cc1C)=N\c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C23H32N2/c1-14-9-16(3)22(17(4)10-14)24-20(7)13-21(8)25-23-18(5)11-15(2)12-19(23)6/h9-12,20,24H,13H2,1-8H3/b25-21+ |
| InChIKey | RQUPHPXHJRLKMJ-NJNXFGOHSA-N |
| XLogP | 6.52 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|