C14H21N — CID 45096866
N-(2,4,6-trimethylphenyl)pentan-3-imine (PubChem CID 45096866) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is N-(2,4,6-trimethylphenyl)pentan-3-imine.
| Compound Name | N-(2,4,6-trimethylphenyl)pentan-3-imine |
|---|---|
| PubChem CID | 45096866 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | N-(2,4,6-trimethylphenyl)pentan-3-imine |
| SMILES | CCC(CC)=Nc1c(C)cc(C)cc1C |
| InChI | InChI=1S/C14H21N/c1-6-13(7-2)15-14-11(4)8-10(3)9-12(14)5/h8-9H,6-7H2,1-5H3 |
| InChIKey | CDGVFPHYBNOEGT-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|