C23H23N — CID 58339608
1,2-diphenyl-N-(2,4,6-trimethylphenyl)ethanimine (PubChem CID 58339608) has the molecular formula C23H23N and a molecular weight of 313.44 g/mol. Its IUPAC name is 1,2-diphenyl-N-(2,4,6-trimethylphenyl)ethanimine.
| Compound Name | 1,2-diphenyl-N-(2,4,6-trimethylphenyl)ethanimine |
|---|---|
| PubChem CID | 58339608 |
| Molecular Formula | C23H23N |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | 1,2-diphenyl-N-(2,4,6-trimethylphenyl)ethanimine |
| SMILES | Cc1cc(C)c(/N=C(\Cc2ccccc2)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C23H23N/c1-17-14-18(2)23(19(3)15-17)24-22(21-12-8-5-9-13-21)16-20-10-6-4-7-11-20/h4-15H,16H2,1-3H3/b24-22+ |
| InChIKey | HTKSZFUXLIWYST-ZNTNEXAZSA-N |
| XLogP | 5.98 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|