C39H41N3 — CID 18719151
1-phenyl-N-(2,4,6-trimethylphenyl)-1-[1,3,4-trimethyl-5-[C-phenyl-N-(2,4,6-trimethylphenyl)carbonimidoyl]pyrrol-2-yl]methanimine (PubChem CID 18719151) has the molecular formula C39H41N3 and a molecular weight of 551.78 g/mol. Its IUPAC name is 1-phenyl-N-(2,4,6-trimethylphenyl)-1-[1,3,4-trimethyl-5-[C-phenyl-N-(2,4,6-trimethylphenyl)carbonimidoyl]pyrrol-2-yl]methanimine.
| Compound Name | 1-phenyl-N-(2,4,6-trimethylphenyl)-1-[1,3,4-trimethyl-5-[C-phenyl-N-(2,4,6-trimethylphenyl)carbonimidoyl]pyrrol-2-yl]methanimine |
|---|---|
| PubChem CID | 18719151 |
| Molecular Formula | C39H41N3 |
| Molecular Weight | 551.78 g/mol |
| Exact Mass | 551.33 |
| IUPAC Name | 1-phenyl-N-(2,4,6-trimethylphenyl)-1-[1,3,4-trimethyl-5-[C-phenyl-N-(2,4,6-trimethylphenyl)carbonimidoyl]pyrrol-2-yl]methanimine |
| SMILES | Cc1cc(C)c(N=C(c2ccccc2)c2c(C)c(C)c(/C(=N\c3c(C)cc(C)cc3C)c3ccccc3)n2C)c(C)c1 |
| InChI | InChI=1S/C39H41N3/c1-24-20-26(3)34(27(4)21-24)40-36(32-16-12-10-13-17-32)38-30(7)31(8)39(42(38)9)37(33-18-14-11-15-19-33)41-35-28(5)22-25(2)23-29(35)6/h10-23H,1-9H3/b40-36-,41-37? |
| InChIKey | LAEPCXMCBMYOJJ-HRZBDODCSA-N |
| XLogP | 9.83 |
| TPSA | 29.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.78 |
| LogP ≤ 5 | 9.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|