C34H35Cl2FeN3 — CID 18718507
dichloroiron;1-phenyl-N'-[2-phenyl-2-(2,4,6-trimethylphenyl)iminoethyl]-N-(2,4,6-trimethylphenyl)ethane-1,2-diimine (PubChem CID 18718507) has the molecular formula C34H35Cl2FeN3 and a molecular weight of 612.43 g/mol. Its IUPAC name is dichloroiron;1-phenyl-N'-[2-phenyl-2-(2,4,6-trimethylphenyl)iminoethyl]-N-(2,4,6-trimethylphenyl)ethane-1,2-diimine.
| Compound Name | dichloroiron;1-phenyl-N'-[2-phenyl-2-(2,4,6-trimethylphenyl)iminoethyl]-N-(2,4,6-trimethylphenyl)ethane-1,2-diimine |
|---|---|
| PubChem CID | 18718507 |
| Molecular Formula | C34H35Cl2FeN3 |
| Molecular Weight | 612.43 g/mol |
| Exact Mass | 611.16 |
| IUPAC Name | dichloroiron;1-phenyl-N'-[2-phenyl-2-(2,4,6-trimethylphenyl)iminoethyl]-N-(2,4,6-trimethylphenyl)ethane-1,2-diimine |
| SMILES | Cc1cc(C)c(/N=C(/C=N\C/C(=N/c2c(C)cc(C)cc2C)c2ccccc2)c2ccccc2)c(C)c1.Cl[Fe]Cl |
| InChI | InChI=1S/C34H35N3.2ClH.Fe/c1-23-17-25(3)33(26(4)18-23)36-31(29-13-9-7-10-14-29)21-35-22-32(30-15-11-8-12-16-30)37-34-27(5)19-24(2)20-28(34)6;;;/h7-21H,22H2,1-6H3;2*1H;/q;;;+2/p-2/b35-21-,36-31-,37-32-;;; |
| InChIKey | IFYBFFCJBCCRNU-JGBURJBASA-L |
| XLogP | 9.93 |
| TPSA | 37.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.43 |
| LogP ≤ 5 | 9.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|