C26H28Cl3FeN3 — CID 163240919
1-[6-[N-(2-chloro-4,6-dimethylphenyl)-C-methylcarbonimidoyl]-2-pyridinyl]-N-(2,4,6-trimethylphenyl)ethanimine;dichloroiron (PubChem CID 163240919) has the molecular formula C26H28Cl3FeN3 and a molecular weight of 544.74 g/mol. Its IUPAC name is 1-[6-[N-(2-chloro-4,6-dimethylphenyl)-C-methylcarbonimidoyl]-2-pyridinyl]-N-(2,4,6-trimethylphenyl)ethanimine;dichloroiron.
| Compound Name | 1-[6-[N-(2-chloro-4,6-dimethylphenyl)-C-methylcarbonimidoyl]-2-pyridinyl]-N-(2,4,6-trimethylphenyl)ethanimine;dichloroiron |
|---|---|
| PubChem CID | 163240919 |
| Molecular Formula | C26H28Cl3FeN3 |
| Molecular Weight | 544.74 g/mol |
| Exact Mass | 543.07 |
| IUPAC Name | 1-[6-[N-(2-chloro-4,6-dimethylphenyl)-C-methylcarbonimidoyl]-2-pyridinyl]-N-(2,4,6-trimethylphenyl)ethanimine;dichloroiron |
| SMILES | C/C(=N\c1c(C)cc(C)cc1C)c1cccc(/C(C)=N/c2c(C)cc(C)cc2Cl)n1.Cl[Fe]Cl |
| InChI | InChI=1S/C26H28ClN3.2ClH.Fe/c1-15-11-17(3)25(18(4)12-15)28-20(6)23-9-8-10-24(30-23)21(7)29-26-19(5)13-16(2)14-22(26)27;;;/h8-14H,1-7H3;2*1H;/q;;;+2/p-2/b28-20+,29-21+;;; |
| InChIKey | NQTJZSBVCKZXRZ-SZARAPANSA-L |
| XLogP | 8.94 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.74 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|