C24H22Cl2FeN4 — CID 24741899
dichloroiron;1-(6-quinoxalin-2-yl-2-pyridinyl)-N-(2,4,6-trimethylphenyl)ethanimine (PubChem CID 24741899) has the molecular formula C24H22Cl2FeN4 and a molecular weight of 493.22 g/mol. Its IUPAC name is dichloroiron;1-(6-quinoxalin-2-yl-2-pyridinyl)-N-(2,4,6-trimethylphenyl)ethanimine.
| Compound Name | dichloroiron;1-(6-quinoxalin-2-yl-2-pyridinyl)-N-(2,4,6-trimethylphenyl)ethanimine |
|---|---|
| PubChem CID | 24741899 |
| Molecular Formula | C24H22Cl2FeN4 |
| Molecular Weight | 493.22 g/mol |
| Exact Mass | 492.06 |
| IUPAC Name | dichloroiron;1-(6-quinoxalin-2-yl-2-pyridinyl)-N-(2,4,6-trimethylphenyl)ethanimine |
| SMILES | C/C(=N\c1c(C)cc(C)cc1C)c1cccc(-c2cnc3ccccc3n2)n1.Cl[Fe]Cl |
| InChI | InChI=1S/C24H22N4.2ClH.Fe/c1-15-12-16(2)24(17(3)13-15)26-18(4)19-10-7-11-22(27-19)23-14-25-20-8-5-6-9-21(20)28-23;;;/h5-14H,1-4H3;2*1H;/q;;;+2/p-2/b26-18+;;; |
| InChIKey | NIBSPVDFJXWDQD-DMVWOWLWSA-L |
| XLogP | 7.13 |
| TPSA | 51.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.22 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|