C25H25Cl5FeN3 — CID 157029122
N-(2-chloro-4,6-dimethylphenyl)-1-[6-[N-(2-chloro-4,6-dimethylphenyl)-C-methylcarbonimidoyl]-2-pyridinyl]ethanimine;trichloroiron (PubChem CID 157029122) has the molecular formula C25H25Cl5FeN3 and a molecular weight of 600.61 g/mol. Its IUPAC name is N-(2-chloro-4,6-dimethylphenyl)-1-[6-[N-(2-chloro-4,6-dimethylphenyl)-C-methylcarbonimidoyl]-2-pyridinyl]ethanimine;trichloroiron.
| Compound Name | N-(2-chloro-4,6-dimethylphenyl)-1-[6-[N-(2-chloro-4,6-dimethylphenyl)-C-methylcarbonimidoyl]-2-pyridinyl]ethanimine;trichloroiron |
|---|---|
| PubChem CID | 157029122 |
| Molecular Formula | C25H25Cl5FeN3 |
| Molecular Weight | 600.61 g/mol |
| Exact Mass | 597.98 |
| IUPAC Name | N-(2-chloro-4,6-dimethylphenyl)-1-[6-[N-(2-chloro-4,6-dimethylphenyl)-C-methylcarbonimidoyl]-2-pyridinyl]ethanimine;trichloroiron |
| SMILES | C/C(=N\c1c(C)cc(C)cc1Cl)c1cccc(/C(C)=N/c2c(C)cc(C)cc2Cl)n1.Cl[Fe](Cl)Cl |
| InChI | InChI=1S/C25H25Cl2N3.3ClH.Fe/c1-14-10-16(3)24(20(26)12-14)28-18(5)22-8-7-9-23(30-22)19(6)29-25-17(4)11-15(2)13-21(25)27;;;;/h7-13H,1-6H3;3*1H;/q;;;;+3/p-3/b28-18+,29-19+;;;; |
| InChIKey | SNDQSNHVOLOFLG-ILCGJTRWSA-K |
| XLogP | 9.97 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.61 |
| LogP ≤ 5 | 9.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|